C20H8F6O6 — CID 139196940
6-(2,4,6-trifluorophenoxy)carbonyloxyhexa-2,4-diynyl (2,4,6-trifluorophenyl) carbonate (PubChem CID 139196940) has the molecular formula C20H8F6O6 and a molecular weight of 458.27 g/mol. Its IUPAC name is 6-(2,4,6-trifluorophenoxy)carbonyloxyhexa-2,4-diynyl (2,4,6-trifluorophenyl) carbonate.
| Compound Name | 6-(2,4,6-trifluorophenoxy)carbonyloxyhexa-2,4-diynyl (2,4,6-trifluorophenyl) carbonate |
|---|---|
| PubChem CID | 139196940 |
| Molecular Formula | C20H8F6O6 |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 6-(2,4,6-trifluorophenoxy)carbonyloxyhexa-2,4-diynyl (2,4,6-trifluorophenyl) carbonate |
| SMILES | O=C(OCC#CC#CCOC(=O)Oc1c(F)cc(F)cc1F)Oc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C20H8F6O6/c21-11-7-13(23)17(14(24)8-11)31-19(27)29-5-3-1-2-4-6-30-20(28)32-18-15(25)9-12(22)10-16(18)26/h7-10H,5-6H2 |
| InChIKey | NLUCSMMNHQLZIC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|