C18H18Cl4N2O4 — CID 139197359
2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;bis(2-methylpyridin-1-ium);dichloride (PubChem CID 139197359) has the molecular formula C18H18Cl4N2O4 and a molecular weight of 468.16 g/mol. Its IUPAC name is 2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;bis(2-methylpyridin-1-ium);dichloride.
| Compound Name | 2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;bis(2-methylpyridin-1-ium);dichloride |
|---|---|
| PubChem CID | 139197359 |
| Molecular Formula | C18H18Cl4N2O4 |
| Molecular Weight | 468.16 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;bis(2-methylpyridin-1-ium);dichloride |
| SMILES | Cc1cccc[nH+]1.Cc1cccc[nH+]1.O=C1C(O)=C(Cl)C(=O)C(O)=C1Cl.[Cl-].[Cl-] |
| InChI | InChI=1S/C6H2Cl2O4.2C6H7N.2ClH/c7-1-3(9)5(11)2(8)6(12)4(1)10;2*1-6-4-2-3-5-7-6;;/h9,12H;2*2-5H,1H3;2*1H |
| InChIKey | KAGQHKWBPMMGFY-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.16 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|