About diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate
diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate (PubChem CID 139197755) has the molecular formula C22H24N4O4S
and a molecular weight of 440.53 g/mol. Its IUPAC name is diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate |
| PubChem CID | 139197755 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(/N=C/c2cccn2C)sc(/N=C/c2cccn2C)c1C(=O)OCC |
| InChI | InChI=1S/C22H24N4O4S/c1-5-29-21(27)17-18(22(28)30-6-2)20(24-14-16-10-8-12-26(16)4)31-19(17)23-13-15-9-7-11-25(15)3/h7-14H,5-6H2,1-4H3/b23-13+,24-14+ |
| InChIKey | ROIBXQIXTYVWKR-RNIAWFEPSA-N |
| XLogP | 4.28 |
| TPSA | 87.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate?
The IUPAC name of diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate (CID 139197755) is diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate.
What is the SMILES notation for diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate?
The canonical SMILES for diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate is CCOC(=O)c1c(/N=C/c2cccn2C)sc(/N=C/c2cccn2C)c1C(=O)OCC.
What is the InChIKey of diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate?
The InChIKey is ROIBXQIXTYVWKR-RNIAWFEPSA-N. The full InChI is InChI=1S/C22H24N4O4S/c1-5-29-21(27)17-18(22(28)30-6-2)20(24-14-16-10-8-12-26(16)4)31-19(17)23-13-15-9-7-11-25(15)3/h7-14H,5-6H2,1-4H3/b23-13+,24-14+.
What are the key properties of diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate?
diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate has a molecular weight of 440.53 g/mol, XLogP of 4.28, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,5-bis[(E)-(1-methylpyrrol-2-yl)methylideneamino]thiophene-3,4-dicarboxylate is sourced from PubChem (CID 139197755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).