C50H46Cl2N8 — CID 139197896
4-(4-chlorophenyl)-2-cyclopropyl-6-(4-pyridin-2-ylpiperazin-1-yl)benzonitrile (PubChem CID 139197896) has the molecular formula C50H46Cl2N8 and a molecular weight of 829.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-cyclopropyl-6-(4-pyridin-2-ylpiperazin-1-yl)benzonitrile.
| Compound Name | 4-(4-chlorophenyl)-2-cyclopropyl-6-(4-pyridin-2-ylpiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 139197896 |
| Molecular Formula | C50H46Cl2N8 |
| Molecular Weight | 829.88 g/mol |
| Exact Mass | 828.32 |
| IUPAC Name | 4-(4-chlorophenyl)-2-cyclopropyl-6-(4-pyridin-2-ylpiperazin-1-yl)benzonitrile |
| SMILES | N#Cc1c(C2CC2)cc(-c2ccc(Cl)cc2)cc1N1CCN(c2ccccn2)CC1.N#Cc1c(C2CC2)cc(-c2ccc(Cl)cc2)cc1N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/2C25H23ClN4/c2*26-21-8-6-18(7-9-21)20-15-22(19-4-5-19)23(17-27)24(16-20)29-11-13-30(14-12-29)25-3-1-2-10-28-25/h2*1-3,6-10,15-16,19H,4-5,11-14H2 |
| InChIKey | PSLVCEVTPZOMFT-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.88 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |