About sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate
sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate (PubChem CID 139197916) has the molecular formula C20H17N2NaO4S
and a molecular weight of 404.42 g/mol. Its IUPAC name is sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate.
Molecular Properties
| Compound Name | sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate |
| PubChem CID | 139197916 |
| Molecular Formula | C20H17N2NaO4S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate |
| SMILES | Oc1ccccc1OCc1cccc(COc2ccccc2O)n1.[N-]=C=S.[Na+] |
| InChI | InChI=1S/C19H17NO4.CNS.Na/c21-16-8-1-3-10-18(16)23-12-14-6-5-7-15(20-14)13-24-19-11-4-2-9-17(19)22;2-1-3;/h1-11,21-22H,12-13H2;;/q;-1;+1 |
| InChIKey | AXUWQIYTUCEYCI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate?
The IUPAC name of sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate (CID 139197916) is sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate.
What is the SMILES notation for sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate?
The canonical SMILES for sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate is Oc1ccccc1OCc1cccc(COc2ccccc2O)n1.[N-]=C=S.[Na+].
What is the InChIKey of sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate?
The InChIKey is AXUWQIYTUCEYCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO4.CNS.Na/c21-16-8-1-3-10-18(16)23-12-14-6-5-7-15(20-14)13-24-19-11-4-2-9-17(19)22;2-1-3;/h1-11,21-22H,12-13H2;;/q;-1;+1.
What are the key properties of sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate?
sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate has a molecular weight of 404.42 g/mol, XLogP of 1.31, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-[[6-[(2-hydroxyphenoxy)methyl]-2-pyridinyl]methoxy]phenol;isothiocyanate is sourced from PubChem (CID 139197916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).