C9H6Cl3F3 — CID 139197978
1,3,5-tris(chloromethyl)-2,4,6-trifluorobenzene (PubChem CID 139197978) has the molecular formula C9H6Cl3F3 and a molecular weight of 277.50 g/mol. Its IUPAC name is 1,3,5-tris(chloromethyl)-2,4,6-trifluorobenzene.
| Compound Name | 1,3,5-tris(chloromethyl)-2,4,6-trifluorobenzene |
|---|---|
| PubChem CID | 139197978 |
| Molecular Formula | C9H6Cl3F3 |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 275.95 |
| IUPAC Name | 1,3,5-tris(chloromethyl)-2,4,6-trifluorobenzene |
| SMILES | Fc1c(CCl)c(F)c(CCl)c(F)c1CCl |
| InChI | InChI=1S/C9H6Cl3F3/c10-1-4-7(13)5(2-11)9(15)6(3-12)8(4)14/h1-3H2 |
| InChIKey | BJQQRDDSMJAPGH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|