C26H23ClFN5O2S — CID 139198041
4-[(E)-(4-chlorophenyl)methylideneamino]-5-(4-fluoro-3-phenoxyphenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 139198041) has the molecular formula C26H23ClFN5O2S and a molecular weight of 524.02 g/mol. Its IUPAC name is 4-[(E)-(4-chlorophenyl)methylideneamino]-5-(4-fluoro-3-phenoxyphenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-[(E)-(4-chlorophenyl)methylideneamino]-5-(4-fluoro-3-phenoxyphenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 139198041 |
| Molecular Formula | C26H23ClFN5O2S |
| Molecular Weight | 524.02 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 4-[(E)-(4-chlorophenyl)methylideneamino]-5-(4-fluoro-3-phenoxyphenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | Fc1ccc(-c2nn(CN3CCOCC3)c(=S)n2/N=C/c2ccc(Cl)cc2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C26H23ClFN5O2S/c27-21-9-6-19(7-10-21)17-29-33-25(30-32(26(33)36)18-31-12-14-34-15-13-31)20-8-11-23(28)24(16-20)35-22-4-2-1-3-5-22/h1-11,16-17H,12-15,18H2/b29-17+ |
| InChIKey | CRKQJFBUFVBGOL-STBIYBPSSA-N |
| XLogP | 5.84 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.02 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|