About benzene-1,2,3-triol;1,10-phenanthroline
benzene-1,2,3-triol;1,10-phenanthroline (PubChem CID 139198239) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is benzene-1,2,3-triol;1,10-phenanthroline.
Molecular Properties
| Compound Name | benzene-1,2,3-triol;1,10-phenanthroline |
| PubChem CID | 139198239 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | benzene-1,2,3-triol;1,10-phenanthroline |
| SMILES | Oc1cccc(O)c1O.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C6H6O3/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;7-4-2-1-3-5(8)6(4)9/h1-8H;1-3,7-9H |
| InChIKey | CRYQCHDTXXJENS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2,3-triol;1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2,3-triol;1,10-phenanthroline?
The IUPAC name of benzene-1,2,3-triol;1,10-phenanthroline (CID 139198239) is benzene-1,2,3-triol;1,10-phenanthroline.
What is the SMILES notation for benzene-1,2,3-triol;1,10-phenanthroline?
The canonical SMILES for benzene-1,2,3-triol;1,10-phenanthroline is Oc1cccc(O)c1O.c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of benzene-1,2,3-triol;1,10-phenanthroline?
The InChIKey is CRYQCHDTXXJENS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C6H6O3/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;7-4-2-1-3-5(8)6(4)9/h1-8H;1-3,7-9H.
What are the key properties of benzene-1,2,3-triol;1,10-phenanthroline?
benzene-1,2,3-triol;1,10-phenanthroline has a molecular weight of 306.32 g/mol, XLogP of 3.59, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2,3-triol;1,10-phenanthroline is sourced from PubChem (CID 139198239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).