C17H20BF4NO2 — CID 139198520
4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium tetrafluoroborate (PubChem CID 139198520) has the molecular formula C17H20BF4NO2 and a molecular weight of 357.16 g/mol. Its IUPAC name is 4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium tetrafluoroborate.
| Compound Name | 4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 139198520 |
| Molecular Formula | C17H20BF4NO2 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium tetrafluoroborate |
| SMILES | CC[n+]1ccc(/C=C/c2ccc(OC)c(OC)c2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C17H20NO2.BF4/c1-4-18-11-9-14(10-12-18)5-6-15-7-8-16(19-2)17(13-15)20-3;2-1(3,4)5/h5-13H,4H2,1-3H3;/q+1;-1/b6-5+; |
| InChIKey | WZINRNUTTPVAIN-IPZCTEOASA-N |
| XLogP | 4.48 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|