C26H21Cl3N2O — CID 139198712
1-[(3S)-3-anthracen-9-yl-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone;chloroform (PubChem CID 139198712) has the molecular formula C26H21Cl3N2O and a molecular weight of 483.83 g/mol. Its IUPAC name is 1-[(3S)-3-anthracen-9-yl-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone;chloroform.
| Compound Name | 1-[(3S)-3-anthracen-9-yl-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone;chloroform |
|---|---|
| PubChem CID | 139198712 |
| Molecular Formula | C26H21Cl3N2O |
| Molecular Weight | 483.83 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 1-[(3S)-3-anthracen-9-yl-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone;chloroform |
| SMILES | CC(=O)N1N=C(c2ccccc2)C[C@H]1c1c2ccccc2cc2ccccc12.ClC(Cl)Cl |
| InChI | InChI=1S/C25H20N2O.CHCl3/c1-17(28)27-24(16-23(26-27)18-9-3-2-4-10-18)25-21-13-7-5-11-19(21)15-20-12-6-8-14-22(20)25;2-1(3)4/h2-15,24H,16H2,1H3;1H/t24-;/m0./s1 |
| InChIKey | NXSSMEQFKGXXQQ-JIDHJSLPSA-N |
| XLogP | 7.68 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.83 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|