C26H50N2O8Si2 — CID 139198822
(1S,6S,7R,8S)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 139198822) has the molecular formula C26H50N2O8Si2 and a molecular weight of 574.86 g/mol. Its IUPAC name is (1S,6S,7R,8S)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,6S,7R,8S)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 139198822 |
| Molecular Formula | C26H50N2O8Si2 |
| Molecular Weight | 574.86 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | (1S,6S,7R,8S)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)N2C[C@H](O)[C@H](O)[C@@H]12.CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)N2C[C@H](O)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/2C13H25NO4Si/c2*1-13(2,3)19(4,5)18-9-6-10(16)14-7-8(15)12(17)11(9)14/h2*8-9,11-12,15,17H,6-7H2,1-5H3/t2*8-,9-,11+,12-/m00/s1 |
| InChIKey | CCMDWLQTHIYHSP-GOPBROIESA-N |
| XLogP | 1.43 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.86 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|