About 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol
1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol (PubChem CID 139198907) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol.
Molecular Properties
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol |
| PubChem CID | 139198907 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol |
| SMILES | C1CN2CCN1CC2.Oc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C12H10O2.C6H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2-8-5-3-7(1)4-6-8/h1-8,13-14H;1-6H2 |
| InChIKey | OWCKAJKJWYWRKU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol?
The IUPAC name of 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol (CID 139198907) is 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol.
What is the SMILES notation for 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol?
The canonical SMILES for 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol is C1CN2CCN1CC2.Oc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol?
The InChIKey is OWCKAJKJWYWRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.C6H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2-8-5-3-7(1)4-6-8/h1-8,13-14H;1-6H2.
What are the key properties of 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol?
1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol has a molecular weight of 298.39 g/mol, XLogP of 2.38, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[2.2.2]octane;4-(4-hydroxyphenyl)phenol is sourced from PubChem (CID 139198907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).