C42H39N5O3S — CID 139198934
2-[(E)-[3-(1,3-benzothiazol-2-yl)-2-hydroxyphenyl]methylideneamino]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 139198934) has the molecular formula C42H39N5O3S and a molecular weight of 693.87 g/mol. Its IUPAC name is 2-[(E)-[3-(1,3-benzothiazol-2-yl)-2-hydroxyphenyl]methylideneamino]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[(E)-[3-(1,3-benzothiazol-2-yl)-2-hydroxyphenyl]methylideneamino]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139198934 |
| Molecular Formula | C42H39N5O3S |
| Molecular Weight | 693.87 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | 2-[(E)-[3-(1,3-benzothiazol-2-yl)-2-hydroxyphenyl]methylideneamino]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1/N=C/c1cccc(-c2nc3ccccc3s2)c1O |
| InChI | InChI=1S/C42H39N5O3S/c1-5-45(6-2)28-20-22-33-36(24-28)50-37-25-29(46(7-3)8-4)21-23-34(37)42(33)32-17-10-9-15-30(32)41(49)47(42)43-26-27-14-13-16-31(39(27)48)40-44-35-18-11-12-19-38(35)51-40/h9-26,48H,5-8H2,1-4H3/b43-26+ |
| InChIKey | LYOQFXNKOJWNSG-BCBUBDITSA-N |
| XLogP | 9.25 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.87 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|