C52H36B2F2N4O2 — CID 139199172
(2R)-2-(2-fluoro-3-pyridinyl)-2-(2-phenylphenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (PubChem CID 139199172) has the molecular formula C52H36B2F2N4O2 and a molecular weight of 808.51 g/mol. Its IUPAC name is (2R)-2-(2-fluoro-3-pyridinyl)-2-(2-phenylphenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene.
| Compound Name | (2R)-2-(2-fluoro-3-pyridinyl)-2-(2-phenylphenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 139199172 |
| Molecular Formula | C52H36B2F2N4O2 |
| Molecular Weight | 808.51 g/mol |
| Exact Mass | 808.30 |
| IUPAC Name | (2R)-2-(2-fluoro-3-pyridinyl)-2-(2-phenylphenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| SMILES | Fc1ncccc1[B@@-]1(c2ccccc2-c2ccccc2)Oc2cccc3ccc[n+]1c23.Fc1ncccc1[B@@-]1(c2ccccc2-c2ccccc2)Oc2cccc3ccc[n+]1c23 |
| InChI | InChI=1S/2C26H18BFN2O/c2*28-26-23(15-7-17-29-26)27(22-14-5-4-13-21(22)19-9-2-1-3-10-19)30-18-8-12-20-11-6-16-24(31-27)25(20)30/h2*1-18H/t2*27-/m11/s1 |
| InChIKey | DLPJYEJAYZAYEN-JOTCDSHRSA-N |
| XLogP | 7.65 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.51 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|