About 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide
2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide (PubChem CID 139199259) has the molecular formula C21H16N2O7
and a molecular weight of 408.37 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide |
| PubChem CID | 139199259 |
| Molecular Formula | C21H16N2O7 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)ccc12 |
| InChI | InChI=1S/C15H10O6.C6H6N2O/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7;7-6(9)5-2-1-3-8-4-5/h1-6,16-18,20H;1-4H,(H2,7,9) |
| InChIKey | WUTWHYDNKFIONL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 167.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide?
The IUPAC name of 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide (CID 139199259) is 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide.
What is the SMILES notation for 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide?
The canonical SMILES for 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide is NC(=O)c1cccnc1.O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)ccc12.
What is the InChIKey of 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide?
The InChIKey is WUTWHYDNKFIONL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O6.C6H6N2O/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7;7-6(9)5-2-1-3-8-4-5/h1-6,16-18,20H;1-4H,(H2,7,9).
What are the key properties of 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide?
2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide has a molecular weight of 408.37 g/mol, XLogP of 2.46, 2 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one;pyridine-3-carboxamide is sourced from PubChem (CID 139199259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).