C16H21NO5 — CID 139199365
benzyl (4aS,7S,7aR)-7-hydroxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrole-5-carboxylate (PubChem CID 139199365) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is benzyl (4aS,7S,7aR)-7-hydroxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrole-5-carboxylate.
| Compound Name | benzyl (4aS,7S,7aR)-7-hydroxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 139199365 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | benzyl (4aS,7S,7aR)-7-hydroxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrole-5-carboxylate |
| SMILES | CC1(C)OC[C@H]2[C@@H](O1)[C@@H](O)CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO5/c1-16(2)21-10-12-14(22-16)13(18)8-17(12)15(19)20-9-11-6-4-3-5-7-11/h3-7,12-14,18H,8-10H2,1-2H3/t12-,13-,14+/m0/s1 |
| InChIKey | BLWAXKNMOSOLRQ-MELADBBJSA-N |
| XLogP | 1.52 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |