About (9-oxophenalen-1-yl) trifluoromethanesulfonate
(9-oxophenalen-1-yl) trifluoromethanesulfonate (PubChem CID 139199435) has the molecular formula C42H21F9O12S3
and a molecular weight of 984.80 g/mol. Its IUPAC name is (9-oxophenalen-1-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (9-oxophenalen-1-yl) trifluoromethanesulfonate |
| PubChem CID | 139199435 |
| Molecular Formula | C42H21F9O12S3 |
| Molecular Weight | 984.80 g/mol |
| Exact Mass | 984.01 |
| IUPAC Name | (9-oxophenalen-1-yl) trifluoromethanesulfonate |
| SMILES | O=C1C=Cc2cccc3ccc(OS(=O)(=O)C(F)(F)F)c1c23.O=C1C=Cc2cccc3ccc(OS(=O)(=O)C(F)(F)F)c1c23.O=C1C=Cc2cccc3ccc(OS(=O)(=O)C(F)(F)F)c1c23 |
| InChI | InChI=1S/3C14H7F3O4S/c3*15-14(16,17)22(19,20)21-11-7-5-9-3-1-2-8-4-6-10(18)13(11)12(8)9/h3*1-7H |
| InChIKey | SMGIHTFDECHKBJ-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 181.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 984.80 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (9-oxophenalen-1-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-oxophenalen-1-yl) trifluoromethanesulfonate?
The IUPAC name of (9-oxophenalen-1-yl) trifluoromethanesulfonate (CID 139199435) is (9-oxophenalen-1-yl) trifluoromethanesulfonate.
What is the SMILES notation for (9-oxophenalen-1-yl) trifluoromethanesulfonate?
The canonical SMILES for (9-oxophenalen-1-yl) trifluoromethanesulfonate is O=C1C=Cc2cccc3ccc(OS(=O)(=O)C(F)(F)F)c1c23.O=C1C=Cc2cccc3ccc(OS(=O)(=O)C(F)(F)F)c1c23.O=C1C=Cc2cccc3ccc(OS(=O)(=O)C(F)(F)F)c1c23.
What is the InChIKey of (9-oxophenalen-1-yl) trifluoromethanesulfonate?
The InChIKey is SMGIHTFDECHKBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C14H7F3O4S/c3*15-14(16,17)22(19,20)21-11-7-5-9-3-1-2-8-4-6-10(18)13(11)12(8)9/h3*1-7H.
What are the key properties of (9-oxophenalen-1-yl) trifluoromethanesulfonate?
(9-oxophenalen-1-yl) trifluoromethanesulfonate has a molecular weight of 984.80 g/mol, XLogP of 9.83, 6 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for (9-oxophenalen-1-yl) trifluoromethanesulfonate is sourced from PubChem (CID 139199435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).