C21H15Cl3N4S — CID 139199570
chloroform;3-prop-2-enyl-2-thiophen-2-ylimidazo[4,5-f][1,10]phenanthroline (PubChem CID 139199570) has the molecular formula C21H15Cl3N4S and a molecular weight of 461.81 g/mol. Its IUPAC name is chloroform;3-prop-2-enyl-2-thiophen-2-ylimidazo[4,5-f][1,10]phenanthroline.
| Compound Name | chloroform;3-prop-2-enyl-2-thiophen-2-ylimidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 139199570 |
| Molecular Formula | C21H15Cl3N4S |
| Molecular Weight | 461.81 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | chloroform;3-prop-2-enyl-2-thiophen-2-ylimidazo[4,5-f][1,10]phenanthroline |
| SMILES | C=CCn1c(-c2cccs2)nc2c3cccnc3c3ncccc3c21.ClC(Cl)Cl |
| InChI | InChI=1S/C20H14N4S.CHCl3/c1-2-11-24-19-14-7-4-10-22-17(14)16-13(6-3-9-21-16)18(19)23-20(24)15-8-5-12-25-15;2-1(3)4/h2-10,12H,1,11H2;1H |
| InChIKey | HHGFPDZEVYGWKO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|