C26H23N5OS — CID 139199573
3-butyl-2-(5-pyridin-4-ylthiophen-2-yl)imidazo[4,5-f][1,10]phenanthroline;hydrate (PubChem CID 139199573) has the molecular formula C26H23N5OS and a molecular weight of 453.57 g/mol. Its IUPAC name is 3-butyl-2-(5-pyridin-4-ylthiophen-2-yl)imidazo[4,5-f][1,10]phenanthroline;hydrate.
| Compound Name | 3-butyl-2-(5-pyridin-4-ylthiophen-2-yl)imidazo[4,5-f][1,10]phenanthroline;hydrate |
|---|---|
| PubChem CID | 139199573 |
| Molecular Formula | C26H23N5OS |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-butyl-2-(5-pyridin-4-ylthiophen-2-yl)imidazo[4,5-f][1,10]phenanthroline;hydrate |
| SMILES | CCCCn1c(-c2ccc(-c3ccncc3)s2)nc2c3cccnc3c3ncccc3c21.O |
| InChI | InChI=1S/C26H21N5S.H2O/c1-2-3-16-31-25-19-7-5-13-29-23(19)22-18(6-4-12-28-22)24(25)30-26(31)21-9-8-20(32-21)17-10-14-27-15-11-17;/h4-15H,2-3,16H2,1H3;1H2 |
| InChIKey | UPMOZWWHVRRHCF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 87.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|