C40H32Cl3N5S — CID 139199575
4-[5-(3-butylimidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]-N,N-diphenylaniline;chloroform (PubChem CID 139199575) has the molecular formula C40H32Cl3N5S and a molecular weight of 721.16 g/mol. Its IUPAC name is 4-[5-(3-butylimidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]-N,N-diphenylaniline;chloroform.
| Compound Name | 4-[5-(3-butylimidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]-N,N-diphenylaniline;chloroform |
|---|---|
| PubChem CID | 139199575 |
| Molecular Formula | C40H32Cl3N5S |
| Molecular Weight | 721.16 g/mol |
| Exact Mass | 719.14 |
| IUPAC Name | 4-[5-(3-butylimidazo[4,5-f][1,10]phenanthrolin-2-yl)thiophen-2-yl]-N,N-diphenylaniline;chloroform |
| SMILES | CCCCn1c(-c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)s2)nc2c3cccnc3c3ncccc3c21.ClC(Cl)Cl |
| InChI | InChI=1S/C39H31N5S.CHCl3/c1-2-3-26-43-38-32-17-11-25-41-36(32)35-31(16-10-24-40-35)37(38)42-39(43)34-23-22-33(45-34)27-18-20-30(21-19-27)44(28-12-6-4-7-13-28)29-14-8-5-9-15-29;2-1(3)4/h4-25H,2-3,26H2,1H3;1H |
| InChIKey | FQKVRCXYRHFDFL-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.16 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|