C10H6Cl4N4O4 — CID 139199682
2-carboxy-3,4,5,6-tetrachlorobenzoate;1H-1,2,4-triazol-4-ium-5-amine (PubChem CID 139199682) has the molecular formula C10H6Cl4N4O4 and a molecular weight of 387.99 g/mol. Its IUPAC name is 2-carboxy-3,4,5,6-tetrachlorobenzoate;1H-1,2,4-triazol-4-ium-5-amine.
| Compound Name | 2-carboxy-3,4,5,6-tetrachlorobenzoate;1H-1,2,4-triazol-4-ium-5-amine |
|---|---|
| PubChem CID | 139199682 |
| Molecular Formula | C10H6Cl4N4O4 |
| Molecular Weight | 387.99 g/mol |
| Exact Mass | 385.91 |
| IUPAC Name | 2-carboxy-3,4,5,6-tetrachlorobenzoate;1H-1,2,4-triazol-4-ium-5-amine |
| SMILES | Nc1[nH]nc[nH+]1.O=C([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/C8H2Cl4O4.C2H4N4/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;3-2-4-1-5-6-2/h(H,13,14)(H,15,16);1H,(H3,3,4,5,6) |
| InChIKey | ANJPHGIYOCDQPV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.99 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|