About 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol
1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol (PubChem CID 139199779) has the molecular formula C25H22N2OS2
and a molecular weight of 430.60 g/mol. Its IUPAC name is 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol |
| PubChem CID | 139199779 |
| Molecular Formula | C25H22N2OS2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol |
| SMILES | Cc1cc(-c2nc(-c3c(O)ccc4ccccc34)[nH]c2-c2cc(C)sc2C)c(C)s1 |
| InChI | InChI=1S/C25H22N2OS2/c1-13-11-19(15(3)29-13)23-24(20-12-14(2)30-16(20)4)27-25(26-23)22-18-8-6-5-7-17(18)9-10-21(22)28/h5-12,28H,1-4H3,(H,26,27) |
| InChIKey | LOHSNXXVFDCOCL-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol?
The IUPAC name of 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol (CID 139199779) is 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol.
What is the SMILES notation for 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol?
The canonical SMILES for 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol is Cc1cc(-c2nc(-c3c(O)ccc4ccccc34)[nH]c2-c2cc(C)sc2C)c(C)s1.
What is the InChIKey of 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol?
The InChIKey is LOHSNXXVFDCOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2OS2/c1-13-11-19(15(3)29-13)23-24(20-12-14(2)30-16(20)4)27-25(26-23)22-18-8-6-5-7-17(18)9-10-21(22)28/h5-12,28H,1-4H3,(H,26,27).
What are the key properties of 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol?
1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol has a molecular weight of 430.60 g/mol, XLogP of 7.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]naphthalen-2-ol is sourced from PubChem (CID 139199779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).