About 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium
3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium (PubChem CID 139200123) has the molecular formula C34H24N2O6
and a molecular weight of 556.57 g/mol. Its IUPAC name is 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium.
Molecular Properties
| Compound Name | 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium |
| PubChem CID | 139200123 |
| Molecular Formula | C34H24N2O6 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium |
| SMILES | O=C(O)c1cc2ccccc2cc1O.O=C(O)c1cc2ccccc2cc1[O-].c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C12H8N2.2C11H8O3/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-8H;2*1-6,12H,(H,13,14) |
| InChIKey | IBNSCMBHCGJNLI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium?
The IUPAC name of 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium (CID 139200123) is 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium.
What is the SMILES notation for 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium?
The canonical SMILES for 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium is O=C(O)c1cc2ccccc2cc1O.O=C(O)c1cc2ccccc2cc1[O-].c1cnc2c(c1)ccc1ccc[nH+]c12.
What is the InChIKey of 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium?
The InChIKey is IBNSCMBHCGJNLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.2C11H8O3/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-8H;2*1-6,12H,(H,13,14).
What are the key properties of 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium?
3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium has a molecular weight of 556.57 g/mol, XLogP of 6.06, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carboxynaphthalen-2-olate;3-hydroxynaphthalene-2-carboxylic acid;1,10-phenanthrolin-10-ium is sourced from PubChem (CID 139200123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).