C24H42O10 — CID 139200423
(3E,5R,6S,8R,14R)-5,6-dihydroxy-14-pentyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxacyclotetradec-3-en-2-one (PubChem CID 139200423) has the molecular formula C24H42O10 and a molecular weight of 490.59 g/mol. Its IUPAC name is (3E,5R,6S,8R,14R)-5,6-dihydroxy-14-pentyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxacyclotetradec-3-en-2-one.
| Compound Name | (3E,5R,6S,8R,14R)-5,6-dihydroxy-14-pentyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxacyclotetradec-3-en-2-one |
|---|---|
| PubChem CID | 139200423 |
| Molecular Formula | C24H42O10 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | (3E,5R,6S,8R,14R)-5,6-dihydroxy-14-pentyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxacyclotetradec-3-en-2-one |
| SMILES | CCCCC[C@@H]1CCCCC[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C[C@H](O)[C@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C24H42O10/c1-2-3-5-8-15-9-6-4-7-10-16(13-18(27)17(26)11-12-20(28)32-15)33-24-23(31)22(30)21(29)19(14-25)34-24/h11-12,15-19,21-27,29-31H,2-10,13-14H2,1H3/b12-11+/t15-,16-,17-,18+,19-,21-,22+,23-,24+/m1/s1 |
| InChIKey | JRUPWHSLHIDIPV-RHDNBBMPSA-N |
| XLogP | 0.30 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|