C18H32O6 — CID 139200426
(3E,5R,6R,7S,8R,14R)-5,6,7,8-tetrahydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one (PubChem CID 139200426) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is (3E,5R,6R,7S,8R,14R)-5,6,7,8-tetrahydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one.
| Compound Name | (3E,5R,6R,7S,8R,14R)-5,6,7,8-tetrahydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one |
|---|---|
| PubChem CID | 139200426 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (3E,5R,6R,7S,8R,14R)-5,6,7,8-tetrahydroxy-14-pentyl-1-oxacyclotetradec-3-en-2-one |
| SMILES | CCCCC[C@@H]1CCCCC[C@@H](O)[C@H](O)[C@H](O)[C@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C18H32O6/c1-2-3-5-8-13-9-6-4-7-10-14(19)17(22)18(23)15(20)11-12-16(21)24-13/h11-15,17-20,22-23H,2-10H2,1H3/b12-11+/t13-,14-,15-,17+,18-/m1/s1 |
| InChIKey | ZMWWERJLHJJXTO-WPCAMVETSA-N |
| XLogP | 1.44 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|