About 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde
5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde (PubChem CID 139200606) has the molecular formula C20H27NO
and a molecular weight of 297.44 g/mol. Its IUPAC name is 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde |
| PubChem CID | 139200606 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccc(C=O)[nH]2)c(C(C)C)c1 |
| InChI | InChI=1S/C20H27NO/c1-12(2)15-9-17(13(3)4)20(18(10-15)14(5)6)19-8-7-16(11-22)21-19/h7-14,21H,1-6H3 |
| InChIKey | AOCNHCYLUJLRPP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde?
The IUPAC name of 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde (CID 139200606) is 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde.
What is the SMILES notation for 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde?
The canonical SMILES for 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde is CC(C)c1cc(C(C)C)c(-c2ccc(C=O)[nH]2)c(C(C)C)c1.
What is the InChIKey of 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde?
The InChIKey is AOCNHCYLUJLRPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO/c1-12(2)15-9-17(13(3)4)20(18(10-15)14(5)6)19-8-7-16(11-22)21-19/h7-14,21H,1-6H3.
What are the key properties of 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde?
5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde has a molecular weight of 297.44 g/mol, XLogP of 5.86, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,4,6-tri(propan-2-yl)phenyl]-1H-pyrrole-2-carbaldehyde is sourced from PubChem (CID 139200606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).