About 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde
5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde (PubChem CID 139200607) has the molecular formula C26H26N2O2
and a molecular weight of 398.51 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde |
| PubChem CID | 139200607 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde |
| SMILES | Cc1cccc(C)c1-c1ccc(C=O)[nH]1.Cc1cccc(C)c1-c1ccc(C=O)[nH]1 |
| InChI | InChI=1S/2C13H13NO/c2*1-9-4-3-5-10(2)13(9)12-7-6-11(8-15)14-12/h2*3-8,14H,1-2H3 |
| InChIKey | GSVZYGABAIPMFU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde?
The IUPAC name of 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde (CID 139200607) is 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde.
What is the SMILES notation for 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde?
The canonical SMILES for 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde is Cc1cccc(C)c1-c1ccc(C=O)[nH]1.Cc1cccc(C)c1-c1ccc(C=O)[nH]1.
What is the InChIKey of 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde?
The InChIKey is GSVZYGABAIPMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H13NO/c2*1-9-4-3-5-10(2)13(9)12-7-6-11(8-15)14-12/h2*3-8,14H,1-2H3.
What are the key properties of 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde?
5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde has a molecular weight of 398.51 g/mol, XLogP of 6.22, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-dimethylphenyl)-1H-pyrrole-2-carbaldehyde is sourced from PubChem (CID 139200607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).