C36H48N2O10 — CID 139200650
5,18-bis(2-ethoxyethyl)-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid (PubChem CID 139200650) has the molecular formula C36H48N2O10 and a molecular weight of 668.78 g/mol. Its IUPAC name is 5,18-bis(2-ethoxyethyl)-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid.
| Compound Name | 5,18-bis(2-ethoxyethyl)-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid |
|---|---|
| PubChem CID | 139200650 |
| Molecular Formula | C36H48N2O10 |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | 5,18-bis(2-ethoxyethyl)-2,8,15,21-tetraoxa-5,18-diazatricyclo[20.4.0.09,14]hexacosa-1(26),9,11,13,22,24-hexaene;terephthalic acid |
| SMILES | CCOCCN1CCOc2ccccc2OCCN(CCOCC)CCOc2ccccc2OCC1.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H42N2O6.C8H6O4/c1-3-31-19-13-29-15-21-33-25-9-5-7-11-27(25)35-23-17-30(14-20-32-4-2)18-24-36-28-12-8-6-10-26(28)34-22-16-29;9-7(10)5-1-2-6(4-3-5)8(11)12/h5-12H,3-4,13-24H2,1-2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | RMTKBCZERBQZDI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|