About bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium
bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium (PubChem CID 139200785) has the molecular formula C32H22N2O6
and a molecular weight of 530.54 g/mol. Its IUPAC name is bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium.
Molecular Properties
| Compound Name | bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium |
| PubChem CID | 139200785 |
| Molecular Formula | C32H22N2O6 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium |
| SMILES | C(=C/c1cc[nH+]cc1)\c1cc[nH+]cc1.O=C1C=C([O-])c2ccccc2C1=O.O=C1C=C([O-])c2ccccc2C1=O |
| InChI | InChI=1S/C12H10N2.2C10H6O3/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-10H;2*1-5,11H/b2-1+;; |
| InChIKey | OZAJDBKOAVJVPU-SEPHDYHBSA-N |
| XLogP | 1.79 |
| TPSA | 142.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium?
The IUPAC name of bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium (CID 139200785) is bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium.
What is the SMILES notation for bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium?
The canonical SMILES for bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium is C(=C/c1cc[nH+]cc1)\c1cc[nH+]cc1.O=C1C=C([O-])c2ccccc2C1=O.O=C1C=C([O-])c2ccccc2C1=O.
What is the InChIKey of bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium?
The InChIKey is OZAJDBKOAVJVPU-SEPHDYHBSA-N. The full InChI is InChI=1S/C12H10N2.2C10H6O3/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-10H;2*1-5,11H/b2-1+;;.
What are the key properties of bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium?
bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium has a molecular weight of 530.54 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,4-dioxonaphthalen-1-olate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium is sourced from PubChem (CID 139200785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).