About 2-methylbenzene-1,3-diol
2-methylbenzene-1,3-diol (PubChem CID 139200813) has the molecular formula C21H24O6
and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-methylbenzene-1,3-diol.
Molecular Properties
| Compound Name | 2-methylbenzene-1,3-diol |
| PubChem CID | 139200813 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-methylbenzene-1,3-diol |
| SMILES | Cc1c(O)cccc1O.Cc1c(O)cccc1O.Cc1c(O)cccc1O |
| InChI | InChI=1S/3C7H8O2/c3*1-5-6(8)3-2-4-7(5)9/h3*2-4,8-9H,1H3 |
| InChIKey | FVBGYWPYENPDQM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzene-1,3-diol?
The IUPAC name of 2-methylbenzene-1,3-diol (CID 139200813) is 2-methylbenzene-1,3-diol.
What is the SMILES notation for 2-methylbenzene-1,3-diol?
The canonical SMILES for 2-methylbenzene-1,3-diol is Cc1c(O)cccc1O.Cc1c(O)cccc1O.Cc1c(O)cccc1O.
What is the InChIKey of 2-methylbenzene-1,3-diol?
The InChIKey is FVBGYWPYENPDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/3C7H8O2/c3*1-5-6(8)3-2-4-7(5)9/h3*2-4,8-9H,1H3.
What are the key properties of 2-methylbenzene-1,3-diol?
2-methylbenzene-1,3-diol has a molecular weight of 372.42 g/mol, XLogP of 4.22, 0 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzene-1,3-diol is sourced from PubChem (CID 139200813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).