About copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate
copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate (PubChem CID 139201616) has the molecular formula C15H13CuN3OS
and a molecular weight of 346.90 g/mol. Its IUPAC name is copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate.
Molecular Properties
| Compound Name | copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate |
| PubChem CID | 139201616 |
| Molecular Formula | C15H13CuN3OS |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate |
| SMILES | Cc1ccc([O-])c(/C=N/Cc2ccccn2)c1.[Cu+2].[N-]=C=S |
| InChI | InChI=1S/C14H14N2O.CNS.Cu/c1-11-5-6-14(17)12(8-11)9-15-10-13-4-2-3-7-16-13;2-1-3;/h2-9,17H,10H2,1H3;;/q;-1;+2/p-1/b15-9+;; |
| InChIKey | LIMODAOGSLIIIE-CBNWXSEKSA-M |
| XLogP | 2.74 |
| TPSA | 70.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate?
The IUPAC name of copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate (CID 139201616) is copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate.
What is the SMILES notation for copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate?
The canonical SMILES for copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate is Cc1ccc([O-])c(/C=N/Cc2ccccn2)c1.[Cu+2].[N-]=C=S.
What is the InChIKey of copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate?
The InChIKey is LIMODAOGSLIIIE-CBNWXSEKSA-M. The full InChI is InChI=1S/C14H14N2O.CNS.Cu/c1-11-5-6-14(17)12(8-11)9-15-10-13-4-2-3-7-16-13;2-1-3;/h2-9,17H,10H2,1H3;;/q;-1;+2/p-1/b15-9+;;.
What are the key properties of copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate?
copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate has a molecular weight of 346.90 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;4-methyl-2-(pyridin-2-ylmethyliminomethyl)phenolate;isothiocyanate is sourced from PubChem (CID 139201616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).