About bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium
bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium (PubChem CID 139202053) has the molecular formula C22H40N2O12P4
and a molecular weight of 648.46 g/mol. Its IUPAC name is bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium.
Molecular Properties
| Compound Name | bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium |
| PubChem CID | 139202053 |
| Molecular Formula | C22H40N2O12P4 |
| Molecular Weight | 648.46 g/mol |
| Exact Mass | 648.15 |
| IUPAC Name | bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium |
| SMILES | O=P([O-])(O)CCCCCCP(=O)(O)O.O=P([O-])(O)CCCCCCP(=O)(O)O.c1cc(-c2cc[nH+]cc2)cc[nH+]1 |
| InChI | InChI=1S/C10H8N2.2C6H16O6P2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*7-13(8,9)5-3-1-2-4-6-14(10,11)12/h1-8H;2*1-6H2,(H2,7,8,9)(H2,10,11,12) |
| InChIKey | BVRHBXZXVPHGEO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 264.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 648.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium?
The IUPAC name of bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium (CID 139202053) is bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium.
What is the SMILES notation for bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium?
The canonical SMILES for bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium is O=P([O-])(O)CCCCCCP(=O)(O)O.O=P([O-])(O)CCCCCCP(=O)(O)O.c1cc(-c2cc[nH+]cc2)cc[nH+]1.
What is the InChIKey of bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium?
The InChIKey is BVRHBXZXVPHGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C6H16O6P2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*7-13(8,9)5-3-1-2-4-6-14(10,11)12/h1-8H;2*1-6H2,(H2,7,8,9)(H2,10,11,12).
What are the key properties of bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium?
bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium has a molecular weight of 648.46 g/mol, XLogP of 1.52, 15 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hydroxy(6-phosphonohexyl)phosphinate);4-pyridin-1-ium-4-ylpyridin-1-ium is sourced from PubChem (CID 139202053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).