About 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate
4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate (PubChem CID 139202070) has the molecular formula C12H20BF7N2S
and a molecular weight of 368.17 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate |
| PubChem CID | 139202070 |
| Molecular Formula | C12H20BF7N2S |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate |
| SMILES | Cc1c(C)[n+](C(C)C)c(SC(F)(F)F)n1C(C)C.F[B-](F)(F)F |
| InChI | InChI=1S/C12H20F3N2S.BF4/c1-7(2)16-9(5)10(6)17(8(3)4)11(16)18-12(13,14)15;2-1(3,4)5/h7-8H,1-6H3;/q+1;-1 |
| InChIKey | CGKNRUCXVQBCDY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate?
The IUPAC name of 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate (CID 139202070) is 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate.
What is the SMILES notation for 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate?
The canonical SMILES for 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate is Cc1c(C)[n+](C(C)C)c(SC(F)(F)F)n1C(C)C.F[B-](F)(F)F.
What is the InChIKey of 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate?
The InChIKey is CGKNRUCXVQBCDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N2S.BF4/c1-7(2)16-9(5)10(6)17(8(3)4)11(16)18-12(13,14)15;2-1(3,4)5/h7-8H,1-6H3;/q+1;-1.
What are the key properties of 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate?
4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate has a molecular weight of 368.17 g/mol, XLogP of 5.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,3-di(propan-2-yl)-2-(trifluoromethylsulfanyl)imidazol-1-ium tetrafluoroborate is sourced from PubChem (CID 139202070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).