C26H18Br2N2O3 — CID 139202159
(5S,7R)-5,7-bis(4-bromophenyl)spiro[1,2,5,7-tetrahydropyrazolo[1,2-a]pyrazole-6,2'-indene]-1',3,3'-trione (PubChem CID 139202159) has the molecular formula C26H18Br2N2O3 and a molecular weight of 566.25 g/mol. Its IUPAC name is (5S,7R)-5,7-bis(4-bromophenyl)spiro[1,2,5,7-tetrahydropyrazolo[1,2-a]pyrazole-6,2'-indene]-1',3,3'-trione.
| Compound Name | (5S,7R)-5,7-bis(4-bromophenyl)spiro[1,2,5,7-tetrahydropyrazolo[1,2-a]pyrazole-6,2'-indene]-1',3,3'-trione |
|---|---|
| PubChem CID | 139202159 |
| Molecular Formula | C26H18Br2N2O3 |
| Molecular Weight | 566.25 g/mol |
| Exact Mass | 563.97 |
| IUPAC Name | (5S,7R)-5,7-bis(4-bromophenyl)spiro[1,2,5,7-tetrahydropyrazolo[1,2-a]pyrazole-6,2'-indene]-1',3,3'-trione |
| SMILES | O=C1CCN2[C@H](c3ccc(Br)cc3)C3(C(=O)c4ccccc4C3=O)[C@H](c3ccc(Br)cc3)N12 |
| InChI | InChI=1S/C26H18Br2N2O3/c27-17-9-5-15(6-10-17)22-26(24(32)19-3-1-2-4-20(19)25(26)33)23(16-7-11-18(28)12-8-16)30-21(31)13-14-29(22)30/h1-12,22-23H,13-14H2/t22-,23+/m1/s1 |
| InChIKey | PFQKKYVINXJMQM-PKTZIBPZSA-N |
| XLogP | 5.52 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.25 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|