C33H27BF2N2 — CID 139202248
2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-phenylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139202248) has the molecular formula C33H27BF2N2 and a molecular weight of 500.40 g/mol. Its IUPAC name is 2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-phenylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-phenylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139202248 |
| Molecular Formula | C33H27BF2N2 |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-phenylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(/C=C/c2ccccc2)=[N+]2C1=C(c1ccccc1)c1c(C)cc(/C=C/c3ccccc3)n1[B-]2(F)F |
| InChI | InChI=1S/C33H27BF2N2/c1-24-22-29(20-18-26-12-6-3-7-13-26)37-32(24)31(28-16-10-5-11-17-28)33-25(2)23-30(38(33)34(37,35)36)21-19-27-14-8-4-9-15-27/h3-23H,1-2H3/b20-18+,21-19+ |
| InChIKey | JIQQEDYMHHYMFT-FRCMOREXSA-N |
| XLogP | 8.09 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|