C20H20Cl2N2O4 — CID 139202288
2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(2,3-dimethylpyridin-1-ium) (PubChem CID 139202288) has the molecular formula C20H20Cl2N2O4 and a molecular weight of 423.30 g/mol. Its IUPAC name is 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(2,3-dimethylpyridin-1-ium).
| Compound Name | 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(2,3-dimethylpyridin-1-ium) |
|---|---|
| PubChem CID | 139202288 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(2,3-dimethylpyridin-1-ium) |
| SMILES | Cc1ccc[nH+]c1C.Cc1ccc[nH+]c1C.O=C1C([O-])=C(Cl)C(=O)C([O-])=C1Cl |
| InChI | InChI=1S/2C7H9N.C6H2Cl2O4/c2*1-6-4-3-5-8-7(6)2;7-1-3(9)5(11)2(8)6(12)4(1)10/h2*3-5H,1-2H3;9,12H |
| InChIKey | ARFAJCIGVYJSPK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 108.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|