C14H18O5 — CID 139202327
(1R,2S,7R,10S,11R,15R)-13,13-dimethyl-9,12,14,16-tetraoxatetracyclo[8.6.0.02,7.011,15]hexadec-3-en-8-one (PubChem CID 139202327) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (1R,2S,7R,10S,11R,15R)-13,13-dimethyl-9,12,14,16-tetraoxatetracyclo[8.6.0.02,7.011,15]hexadec-3-en-8-one.
| Compound Name | (1R,2S,7R,10S,11R,15R)-13,13-dimethyl-9,12,14,16-tetraoxatetracyclo[8.6.0.02,7.011,15]hexadec-3-en-8-one |
|---|---|
| PubChem CID | 139202327 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1R,2S,7R,10S,11R,15R)-13,13-dimethyl-9,12,14,16-tetraoxatetracyclo[8.6.0.02,7.011,15]hexadec-3-en-8-one |
| SMILES | CC1(C)O[C@H]2O[C@@H]3[C@H]4C=CCC[C@H]4C(=O)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C14H18O5/c1-14(2)18-11-10-9(17-13(11)19-14)7-5-3-4-6-8(7)12(15)16-10/h3,5,7-11,13H,4,6H2,1-2H3/t7-,8+,9+,10-,11+,13+/m0/s1 |
| InChIKey | NZQOIKDRBBBACR-PDXZJBCCSA-N |
| XLogP | 1.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|