About piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate
piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate (PubChem CID 139202381) has the molecular formula C14H36N6O7
and a molecular weight of 400.48 g/mol. Its IUPAC name is piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate.
Molecular Properties
| Compound Name | piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate |
| PubChem CID | 139202381 |
| Molecular Formula | C14H36N6O7 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate |
| SMILES | C1C[NH2+]CCN1.C1C[NH2+]CCN1.O.O.O.O=C([O-])N1CCN(C(=O)[O-])CC1 |
| InChI | InChI=1S/C6H10N2O4.2C4H10N2.3H2O/c9-5(10)7-1-2-8(4-3-7)6(11)12;2*1-2-6-4-3-5-1;;;/h1-4H2,(H,9,10)(H,11,12);2*5-6H,1-4H2;3*1H2 |
| InChIKey | YSDBWCXHQCCMLZ-UHFFFAOYSA-N |
| XLogP | -8.88 |
| TPSA | 238.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | -8.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate?
The IUPAC name of piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate (CID 139202381) is piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate.
What is the SMILES notation for piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate?
The canonical SMILES for piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate is C1C[NH2+]CCN1.C1C[NH2+]CCN1.O.O.O.O=C([O-])N1CCN(C(=O)[O-])CC1.
What is the InChIKey of piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate?
The InChIKey is YSDBWCXHQCCMLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O4.2C4H10N2.3H2O/c9-5(10)7-1-2-8(4-3-7)6(11)12;2*1-2-6-4-3-5-1;;;/h1-4H2,(H,9,10)(H,11,12);2*5-6H,1-4H2;3*1H2.
What are the key properties of piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate?
piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate has a molecular weight of 400.48 g/mol, XLogP of -8.88, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1,4-dicarboxylate;bis(piperazin-1-ium);trihydrate is sourced from PubChem (CID 139202381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).