C22H24F2N2O2S2 — CID 139202531
(2Z,11Z)-3,11-bis(4-fluorophenyl)-1,13-dioxa-5,9-dithia-2,12-diazacyclohexadeca-2,11-diene (PubChem CID 139202531) has the molecular formula C22H24F2N2O2S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is (2Z,11Z)-3,11-bis(4-fluorophenyl)-1,13-dioxa-5,9-dithia-2,12-diazacyclohexadeca-2,11-diene.
| Compound Name | (2Z,11Z)-3,11-bis(4-fluorophenyl)-1,13-dioxa-5,9-dithia-2,12-diazacyclohexadeca-2,11-diene |
|---|---|
| PubChem CID | 139202531 |
| Molecular Formula | C22H24F2N2O2S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (2Z,11Z)-3,11-bis(4-fluorophenyl)-1,13-dioxa-5,9-dithia-2,12-diazacyclohexadeca-2,11-diene |
| SMILES | Fc1ccc(/C2=N/OCCCO/N=C(\c3ccc(F)cc3)CSCCCSC2)cc1 |
| InChI | InChI=1S/C22H24F2N2O2S2/c23-19-7-3-17(4-8-19)21-15-29-13-2-14-30-16-22(18-5-9-20(24)10-6-18)26-28-12-1-11-27-25-21/h3-10H,1-2,11-16H2/b25-21-,26-22+ |
| InChIKey | VTXUPEPXGLBNBM-KOUJMYIZSA-N |
| XLogP | 5.37 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |