About (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide
(E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide (PubChem CID 139202974) has the molecular formula C21H18N2O5
and a molecular weight of 378.38 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide |
| PubChem CID | 139202974 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.O=C(/C=C/c1ccc(O)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H12O4.C6H6N2O/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19;7-6(9)5-2-1-3-8-4-5/h1-9,16-17,19H;1-4H,(H2,7,9)/b8-3+; |
| InChIKey | WVTHYIZYXHNSQQ-DCDCITSCSA-N |
| XLogP | 2.88 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide?
The IUPAC name of (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide (CID 139202974) is (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide.
What is the SMILES notation for (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide?
The canonical SMILES for (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide is NC(=O)c1cccnc1.O=C(/C=C/c1ccc(O)cc1)c1ccc(O)cc1O.
What is the InChIKey of (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide?
The InChIKey is WVTHYIZYXHNSQQ-DCDCITSCSA-N. The full InChI is InChI=1S/C15H12O4.C6H6N2O/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19;7-6(9)5-2-1-3-8-4-5/h1-9,16-17,19H;1-4H,(H2,7,9)/b8-3+;.
What are the key properties of (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide?
(E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide has a molecular weight of 378.38 g/mol, XLogP of 2.88, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one;pyridine-3-carboxamide is sourced from PubChem (CID 139202974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).