About ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate
ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate (PubChem CID 139202975) has the molecular formula C18H14N2O4S2
and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate |
| PubChem CID | 139202975 |
| Molecular Formula | C18H14N2O4S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate |
| SMILES | CCOC(=O)Cn1c(O)c2c(c1-c1cccs1)C(=O)N=C2c1cccs1 |
| InChI | InChI=1S/C18H14N2O4S2/c1-2-24-12(21)9-20-16(11-6-4-8-26-11)14-13(18(20)23)15(19-17(14)22)10-5-3-7-25-10/h3-8,23H,2,9H2,1H3 |
| InChIKey | IFGQJJAYNZTXMY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate?
The IUPAC name of ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate (CID 139202975) is ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate.
What is the SMILES notation for ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate?
The canonical SMILES for ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate is CCOC(=O)Cn1c(O)c2c(c1-c1cccs1)C(=O)N=C2c1cccs1.
What is the InChIKey of ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate?
The InChIKey is IFGQJJAYNZTXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O4S2/c1-2-24-12(21)9-20-16(11-6-4-8-26-11)14-13(18(20)23)15(19-17(14)22)10-5-3-7-25-10/h3-8,23H,2,9H2,1H3.
What are the key properties of ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate?
ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate has a molecular weight of 386.45 g/mol, XLogP of 3.54, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6-hydroxy-3-oxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-5-yl)acetate is sourced from PubChem (CID 139202975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).