C25H20O8 — CID 139202978
4,4,4',4'-tetramethyl-2,2'-spirobi[3H-furo[3,4-g]chromene]-6,6',8,8'-tetrone (PubChem CID 139202978) has the molecular formula C25H20O8 and a molecular weight of 448.43 g/mol. Its IUPAC name is 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-furo[3,4-g]chromene]-6,6',8,8'-tetrone.
| Compound Name | 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-furo[3,4-g]chromene]-6,6',8,8'-tetrone |
|---|---|
| PubChem CID | 139202978 |
| Molecular Formula | C25H20O8 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-furo[3,4-g]chromene]-6,6',8,8'-tetrone |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc4c(cc3O2)C(=O)OC4=O)Oc2cc3c(cc21)C(=O)OC3=O |
| InChI | InChI=1S/C25H20O8/c1-23(2)9-25(32-17-7-13-11(5-15(17)23)19(26)30-21(13)28)10-24(3,4)16-6-12-14(8-18(16)33-25)22(29)31-20(12)27/h5-8H,9-10H2,1-4H3 |
| InChIKey | ZLJXHJCUBBXLOC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|