C42H34F6 — CID 139203253
1,6,7,10-tetramethyl-8-(trifluoromethyl)fluoranthene (PubChem CID 139203253) has the molecular formula C42H34F6 and a molecular weight of 652.72 g/mol. Its IUPAC name is 1,6,7,10-tetramethyl-8-(trifluoromethyl)fluoranthene.
| Compound Name | 1,6,7,10-tetramethyl-8-(trifluoromethyl)fluoranthene |
|---|---|
| PubChem CID | 139203253 |
| Molecular Formula | C42H34F6 |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | 1,6,7,10-tetramethyl-8-(trifluoromethyl)fluoranthene |
| SMILES | Cc1cc(C(F)(F)F)c(C)c2c1-c1c(C)ccc3ccc(C)c-2c13.Cc1cc(C(F)(F)F)c(C)c2c1-c1c(C)ccc3ccc(C)c-2c13 |
| InChI | InChI=1S/2C21H17F3/c2*1-10-5-7-14-8-6-11(2)17-19-13(4)15(21(22,23)24)9-12(3)18(19)16(10)20(14)17/h2*5-9H,1-4H3 |
| InChIKey | XPIXXGYRGKHAAA-UHFFFAOYSA-N |
| XLogP | 13.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |