C38H22N4O8 — CID 139203267
4-[2,3,7-tris(4-carboxyphenyl)pyrazino[2,3-g]quinoxalin-8-yl]benzoic acid (PubChem CID 139203267) has the molecular formula C38H22N4O8 and a molecular weight of 662.61 g/mol. Its IUPAC name is 4-[2,3,7-tris(4-carboxyphenyl)pyrazino[2,3-g]quinoxalin-8-yl]benzoic acid.
| Compound Name | 4-[2,3,7-tris(4-carboxyphenyl)pyrazino[2,3-g]quinoxalin-8-yl]benzoic acid |
|---|---|
| PubChem CID | 139203267 |
| Molecular Formula | C38H22N4O8 |
| Molecular Weight | 662.61 g/mol |
| Exact Mass | 662.14 |
| IUPAC Name | 4-[2,3,7-tris(4-carboxyphenyl)pyrazino[2,3-g]quinoxalin-8-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc3cc4nc(-c5ccc(C(=O)O)cc5)c(-c5ccc(C(=O)O)cc5)nc4cc3nc2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C38H22N4O8/c43-35(44)23-9-1-19(2-10-23)31-32(20-3-11-24(12-4-20)36(45)46)40-28-18-30-29(17-27(28)39-31)41-33(21-5-13-25(14-6-21)37(47)48)34(42-30)22-7-15-26(16-8-22)38(49)50/h1-18H,(H,43,44)(H,45,46)(H,47,48)(H,49,50) |
| InChIKey | BBMPHLZUTCPFIZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 200.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|