About bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine
bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine (PubChem CID 139203390) has the molecular formula C26H22B2F2N2O4
and a molecular weight of 486.09 g/mol. Its IUPAC name is bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine.
Molecular Properties
| Compound Name | bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| PubChem CID | 139203390 |
| Molecular Formula | C26H22B2F2N2O4 |
| Molecular Weight | 486.09 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| SMILES | C(=C/c1ccncc1)\c1ccncc1.OB1OCc2cc(F)ccc21.OB1OCc2cc(F)ccc21 |
| InChI | InChI=1S/C12H10N2.2C7H6BFO2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*9-6-1-2-7-5(3-6)4-11-8(7)10/h1-10H;2*1-3,10H,4H2/b2-1+;; |
| InChIKey | QSLBYLBBMUWNEN-SEPHDYHBSA-N |
| XLogP | 2.73 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The IUPAC name of bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine (CID 139203390) is bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine.
What is the SMILES notation for bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The canonical SMILES for bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine is C(=C/c1ccncc1)\c1ccncc1.OB1OCc2cc(F)ccc21.OB1OCc2cc(F)ccc21.
What is the InChIKey of bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The InChIKey is QSLBYLBBMUWNEN-SEPHDYHBSA-N. The full InChI is InChI=1S/C12H10N2.2C7H6BFO2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*9-6-1-2-7-5(3-6)4-11-8(7)10/h1-10H;2*1-3,10H,4H2/b2-1+;;.
What are the key properties of bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine has a molecular weight of 486.09 g/mol, XLogP of 2.73, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborole);4-[(E)-2-pyridin-4-ylethenyl]pyridine is sourced from PubChem (CID 139203390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).