C12H10F13IN2S — CID 139203393
3-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)-1H-imidazol-3-ium iodide (PubChem CID 139203393) has the molecular formula C12H10F13IN2S and a molecular weight of 588.17 g/mol. Its IUPAC name is 3-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)-1H-imidazol-3-ium iodide.
| Compound Name | 3-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)-1H-imidazol-3-ium iodide |
|---|---|
| PubChem CID | 139203393 |
| Molecular Formula | C12H10F13IN2S |
| Molecular Weight | 588.17 g/mol |
| Exact Mass | 587.94 |
| IUPAC Name | 3-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)-1H-imidazol-3-ium iodide |
| SMILES | C[n+]1cc[nH]c1SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[I-] |
| InChI | InChI=1S/C12H9F13N2S.HI/c1-27-4-3-26-6(27)28-5-2-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25;/h3-4H,2,5H2,1H3;1H |
| InChIKey | FCTSRQJNHMRDCY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|