C20H13F26IN2S — CID 139203398
1-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazol-1-ium iodide (PubChem CID 139203398) has the molecular formula C20H13F26IN2S and a molecular weight of 934.26 g/mol. Its IUPAC name is 1-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazol-1-ium iodide.
| Compound Name | 1-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazol-1-ium iodide |
|---|---|
| PubChem CID | 139203398 |
| Molecular Formula | C20H13F26IN2S |
| Molecular Weight | 934.26 g/mol |
| Exact Mass | 933.94 |
| IUPAC Name | 1-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazol-1-ium iodide |
| SMILES | C[n+]1ccn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[I-] |
| InChI | InChI=1S/C20H13F26N2S.HI/c1-47-5-6-48(4-2-9(21,22)11(25,26)13(29,30)15(33,34)17(37,38)19(41,42)43)8(47)49-7-3-10(23,24)12(27,28)14(31,32)16(35,36)18(39,40)20(44,45)46;/h5-6H,2-4,7H2,1H3;1H/q+1;/p-1 |
| InChIKey | CTMGVPBCBBEFSI-UHFFFAOYSA-M |
| XLogP | 6.67 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.26 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|