About 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine)
1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine) (PubChem CID 139203442) has the molecular formula C23H20Cl2N8O2
and a molecular weight of 511.37 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine).
Molecular Properties
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine) |
| PubChem CID | 139203442 |
| Molecular Formula | C23H20Cl2N8O2 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine) |
| SMILES | Nc1ncccn1.Nc1ncccn1.O=C(O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C15H10Cl2N2O2.2C4H5N3/c16-10-6-5-9(12(17)7-10)8-19-13-4-2-1-3-11(13)14(18-19)15(20)21;2*5-4-6-2-1-3-7-4/h1-7H,8H2,(H,20,21);2*1-3H,(H2,5,6,7) |
| InChIKey | WSPPNDSSDRNFMZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine)?
The IUPAC name of 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine) (CID 139203442) is 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine).
What is the SMILES notation for 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine)?
The canonical SMILES for 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine) is Nc1ncccn1.Nc1ncccn1.O=C(O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12.
What is the InChIKey of 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine)?
The InChIKey is WSPPNDSSDRNFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2N2O2.2C4H5N3/c16-10-6-5-9(12(17)7-10)8-19-13-4-2-1-3-11(13)14(18-19)15(20)21;2*5-4-6-2-1-3-7-4/h1-7H,8H2,(H,20,21);2*1-3H,(H2,5,6,7).
What are the key properties of 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine)?
1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine) has a molecular weight of 511.37 g/mol, XLogP of 4.21, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;bis(pyrimidin-2-amine) is sourced from PubChem (CID 139203442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).