C21H16Cl2N4O3 — CID 139203447
1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;pyridine-4-carboxamide (PubChem CID 139203447) has the molecular formula C21H16Cl2N4O3 and a molecular weight of 443.29 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;pyridine-4-carboxamide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139203447 |
| Molecular Formula | C21H16Cl2N4O3 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid;pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccncc1.O=C(O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C15H10Cl2N2O2.C6H6N2O/c16-10-6-5-9(12(17)7-10)8-19-13-4-2-1-3-11(13)14(18-19)15(20)21;7-6(9)5-1-3-8-4-2-5/h1-7H,8H2,(H,20,21);1-4H,(H2,7,9) |
| InChIKey | XYUJODWTYZEGKO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |