C38H20N4 — CID 139203548
2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile;hexahelicene (PubChem CID 139203548) has the molecular formula C38H20N4 and a molecular weight of 532.61 g/mol. Its IUPAC name is 2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile;hexahelicene.
| Compound Name | 2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile;hexahelicene |
|---|---|
| PubChem CID | 139203548 |
| Molecular Formula | C38H20N4 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile;hexahelicene |
| SMILES | N#CC(C#N)=c1ccc(=C(C#N)C#N)cc1.c1ccc2c(c1)ccc1ccc3ccc4ccc5ccccc5c4c3c12 |
| InChI | InChI=1S/C26H16.C12H4N4/c1-3-7-22-17(5-1)9-11-19-13-15-21-16-14-20-12-10-18-6-2-4-8-23(18)25(20)26(21)24(19)22;13-5-11(6-14)9-1-2-10(4-3-9)12(7-15)8-16/h1-16H;1-4H |
| InChIKey | GQSSISAQJAYNRW-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|